C22H36O4S — CID 70428411
(Z)-7-[(1S,2S,3R,4R)-3-(2-cyclohexylsulfonylethyl)-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid (PubChem CID 70428411) has the molecular formula C22H36O4S and a molecular weight of 396.59 g/mol. Its IUPAC name is (Z)-7-[(1S,2S,3R,4R)-3-(2-cyclohexylsulfonylethyl)-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1S,2S,3R,4R)-3-(2-cyclohexylsulfonylethyl)-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70428411 |
| Molecular Formula | C22H36O4S |
| Molecular Weight | 396.59 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | (Z)-7-[(1S,2S,3R,4R)-3-(2-cyclohexylsulfonylethyl)-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\C[C@H]1[C@H]2CC[C@H](C2)[C@H]1CCS(=O)(=O)C1CCCCC1 |
| InChI | InChI=1S/C22H36O4S/c23-22(24)11-7-2-1-6-10-20-17-12-13-18(16-17)21(20)14-15-27(25,26)19-8-4-3-5-9-19/h1,6,17-21H,2-5,7-16H2,(H,23,24)/b6-1-/t17-,18+,20-,21+/m0/s1 |
| InChIKey | AKIJFNOUVIUEHR-OZONUKACSA-N |
| XLogP | 4.99 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.59 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|