C24H34O2S — CID 54028185
7-[(1S,2S,3R,4R)-3-(4-phenylsulfanylbutyl)-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid (PubChem CID 54028185) has the molecular formula C24H34O2S and a molecular weight of 386.60 g/mol. Its IUPAC name is 7-[(1S,2S,3R,4R)-3-(4-phenylsulfanylbutyl)-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid.
| Compound Name | 7-[(1S,2S,3R,4R)-3-(4-phenylsulfanylbutyl)-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 54028185 |
| Molecular Formula | C24H34O2S |
| Molecular Weight | 386.60 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | 7-[(1S,2S,3R,4R)-3-(4-phenylsulfanylbutyl)-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid |
| SMILES | O=C(O)CCCC=CC[C@H]1[C@H]2CC[C@H](C2)[C@H]1CCCCSc1ccccc1 |
| InChI | InChI=1S/C24H34O2S/c25-24(26)14-7-2-1-6-12-22-19-15-16-20(18-19)23(22)13-8-9-17-27-21-10-4-3-5-11-21/h1,3-6,10-11,19-20,22-23H,2,7-9,12-18H2,(H,25,26)/t19-,20+,22-,23+/m0/s1 |
| InChIKey | LDRVCOQVMODISW-PABCKOPISA-N |
| XLogP | 6.81 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.60 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|