C19H24O3S — CID 54059802
7-[(1R,2S,3S,4S)-3-phenylsulfanyl-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid (PubChem CID 54059802) has the molecular formula C19H24O3S and a molecular weight of 332.47 g/mol. Its IUPAC name is 7-[(1R,2S,3S,4S)-3-phenylsulfanyl-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2S,3S,4S)-3-phenylsulfanyl-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 54059802 |
| Molecular Formula | C19H24O3S |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 7-[(1R,2S,3S,4S)-3-phenylsulfanyl-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
| SMILES | O=C(O)CCCC=CC[C@@H]1[C@H](Sc2ccccc2)[C@@H]2CC[C@H]1O2 |
| InChI | InChI=1S/C19H24O3S/c20-18(21)11-7-2-1-6-10-15-16-12-13-17(22-16)19(15)23-14-8-4-3-5-9-14/h1,3-6,8-9,15-17,19H,2,7,10-13H2,(H,20,21)/t15-,16+,17-,19-/m0/s1 |
| InChIKey | LYWCLBJISWOVDU-ZMMAXQRCSA-N |
| XLogP | 4.53 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|