C21H28O5S — CID 54468717
7-[(1R,2R,3S,4S)-3-(benzylsulfonylmethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid (PubChem CID 54468717) has the molecular formula C21H28O5S and a molecular weight of 392.52 g/mol. Its IUPAC name is 7-[(1R,2R,3S,4S)-3-(benzylsulfonylmethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2R,3S,4S)-3-(benzylsulfonylmethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 54468717 |
| Molecular Formula | C21H28O5S |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 7-[(1R,2R,3S,4S)-3-(benzylsulfonylmethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
| SMILES | O=C(O)CCCC=CC[C@@H]1[C@H](CS(=O)(=O)Cc2ccccc2)[C@@H]2CC[C@H]1O2 |
| InChI | InChI=1S/C21H28O5S/c22-21(23)11-7-2-1-6-10-17-18(20-13-12-19(17)26-20)15-27(24,25)14-16-8-4-3-5-9-16/h1,3-6,8-9,17-20H,2,7,10-15H2,(H,22,23)/t17-,18+,19-,20+/m1/s1 |
| InChIKey | XGUDUXBHLXGXSA-WCIQWLHISA-N |
| XLogP | 3.60 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|