C26H38O3S2 — CID 54221820
7-[(1R,2R,3S,4S)-3-[2-(4-benzylsulfanylbutylsulfanyl)ethyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid (PubChem CID 54221820) has the molecular formula C26H38O3S2 and a molecular weight of 462.72 g/mol. Its IUPAC name is 7-[(1R,2R,3S,4S)-3-[2-(4-benzylsulfanylbutylsulfanyl)ethyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2R,3S,4S)-3-[2-(4-benzylsulfanylbutylsulfanyl)ethyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 54221820 |
| Molecular Formula | C26H38O3S2 |
| Molecular Weight | 462.72 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | 7-[(1R,2R,3S,4S)-3-[2-(4-benzylsulfanylbutylsulfanyl)ethyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
| SMILES | O=C(O)CCCC=CC[C@@H]1[C@H](CCSCCCCSCc2ccccc2)[C@@H]2CC[C@H]1O2 |
| InChI | InChI=1S/C26H38O3S2/c27-26(28)13-7-2-1-6-12-22-23(25-15-14-24(22)29-25)16-19-30-17-8-9-18-31-20-21-10-4-3-5-11-21/h1,3-6,10-11,22-25H,2,7-9,12-20H2,(H,27,28)/t22-,23+,24-,25+/m1/s1 |
| InChIKey | QDCRBAPHTIRRME-RCTAOEEJSA-N |
| XLogP | 6.82 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.72 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|