C23H35NO3S2 — CID 54011731
5-[2-[(1R,2R,3S,4S)-3-(2-benzylsulfanylethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]ethylsulfanyl]-N-hydroxy-N-methylpentanamide (PubChem CID 54011731) has the molecular formula C23H35NO3S2 and a molecular weight of 437.67 g/mol. Its IUPAC name is 5-[2-[(1R,2R,3S,4S)-3-(2-benzylsulfanylethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]ethylsulfanyl]-N-hydroxy-N-methylpentanamide.
| Compound Name | 5-[2-[(1R,2R,3S,4S)-3-(2-benzylsulfanylethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]ethylsulfanyl]-N-hydroxy-N-methylpentanamide |
|---|---|
| PubChem CID | 54011731 |
| Molecular Formula | C23H35NO3S2 |
| Molecular Weight | 437.67 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | 5-[2-[(1R,2R,3S,4S)-3-(2-benzylsulfanylethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]ethylsulfanyl]-N-hydroxy-N-methylpentanamide |
| SMILES | CN(O)C(=O)CCCCSCC[C@@H]1[C@H](CCSCc2ccccc2)[C@@H]2CC[C@H]1O2 |
| InChI | InChI=1S/C23H35NO3S2/c1-24(26)23(25)9-5-6-14-28-15-12-19-20(22-11-10-21(19)27-22)13-16-29-17-18-7-3-2-4-8-18/h2-4,7-8,19-22,26H,5-6,9-17H2,1H3/t19-,20+,21-,22+/m1/s1 |
| InChIKey | KSVKTYDPTUVLKN-MBDNFAEBSA-N |
| XLogP | 5.24 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.67 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|