C28H38O3S — CID 54527828
7-[(1R,2R,3S,4S)-3-(8-phenyloct-5-ynylsulfanylmethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid (PubChem CID 54527828) has the molecular formula C28H38O3S and a molecular weight of 454.68 g/mol. Its IUPAC name is 7-[(1R,2R,3S,4S)-3-(8-phenyloct-5-ynylsulfanylmethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2R,3S,4S)-3-(8-phenyloct-5-ynylsulfanylmethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 54527828 |
| Molecular Formula | C28H38O3S |
| Molecular Weight | 454.68 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | 7-[(1R,2R,3S,4S)-3-(8-phenyloct-5-ynylsulfanylmethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
| SMILES | O=C(O)CCCC=CC[C@@H]1[C@H](CSCCCCC#CCCc2ccccc2)[C@@H]2CC[C@H]1O2 |
| InChI | InChI=1S/C28H38O3S/c29-28(30)18-12-5-4-11-17-24-25(27-20-19-26(24)31-27)22-32-21-13-6-2-1-3-8-14-23-15-9-7-10-16-23/h4,7,9-11,15-16,24-27H,2,5-6,8,12-14,17-22H2,(H,29,30)/t24-,25+,26-,27+/m1/s1 |
| InChIKey | YUIVIEIVMQJTJV-RAVGUYNFSA-N |
| XLogP | 6.52 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.68 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|