C24H34O4S — CID 70510239
(Z)-7-[(1R,2R,3S,4S)-3-[2-(3-phenylpropylsulfinyl)ethyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid (PubChem CID 70510239) has the molecular formula C24H34O4S and a molecular weight of 418.60 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3S,4S)-3-[2-(3-phenylpropylsulfinyl)ethyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,3S,4S)-3-[2-(3-phenylpropylsulfinyl)ethyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70510239 |
| Molecular Formula | C24H34O4S |
| Molecular Weight | 418.60 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | (Z)-7-[(1R,2R,3S,4S)-3-[2-(3-phenylpropylsulfinyl)ethyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\C[C@@H]1[C@H](CCS(=O)CCCc2ccccc2)[C@@H]2CC[C@H]1O2 |
| InChI | InChI=1S/C24H34O4S/c25-24(26)13-7-2-1-6-12-20-21(23-15-14-22(20)28-23)16-18-29(27)17-8-11-19-9-4-3-5-10-19/h1,3-6,9-10,20-23H,2,7-8,11-18H2,(H,25,26)/b6-1-/t20-,21+,22-,23+,29?/m1/s1 |
| InChIKey | YKPJRAZXTHELGK-ZBUOMZRTSA-N |
| XLogP | 4.75 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.60 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|