C30H43NO3S — CID 88661966
(Z)-N-hydroxy-2,2-dimethyl-7-[(1S,2S,3R,4R)-3-(8-phenyloct-5-ynylsulfanylmethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enamide (PubChem CID 88661966) has the molecular formula C30H43NO3S and a molecular weight of 497.75 g/mol. Its IUPAC name is (Z)-N-hydroxy-2,2-dimethyl-7-[(1S,2S,3R,4R)-3-(8-phenyloct-5-ynylsulfanylmethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enamide.
| Compound Name | (Z)-N-hydroxy-2,2-dimethyl-7-[(1S,2S,3R,4R)-3-(8-phenyloct-5-ynylsulfanylmethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enamide |
|---|---|
| PubChem CID | 88661966 |
| Molecular Formula | C30H43NO3S |
| Molecular Weight | 497.75 g/mol |
| Exact Mass | 497.30 |
| IUPAC Name | (Z)-N-hydroxy-2,2-dimethyl-7-[(1S,2S,3R,4R)-3-(8-phenyloct-5-ynylsulfanylmethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enamide |
| SMILES | CC(C)(CC/C=C\C[C@H]1[C@@H](CSCCCCC#CCCc2ccccc2)[C@H]2CC[C@@H]1O2)C(=O)NO |
| InChI | InChI=1S/C30H43NO3S/c1-30(2,29(32)31-33)21-13-8-12-18-25-26(28-20-19-27(25)34-28)23-35-22-14-6-4-3-5-9-15-24-16-10-7-11-17-24/h7-8,10-12,16-17,25-28,33H,4,6,9,13-15,18-23H2,1-2H3,(H,31,32)/b12-8-/t25-,26+,27-,28+/m0/s1 |
| InChIKey | DQTIHAZLGNXEGH-ZQDAIDKFSA-N |
| XLogP | 6.58 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.75 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|