C23H41NO4 — CID 88661269
(Z)-7-[(1S,2S,3R,4R)-3-(2-hexoxyethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]-N-hydroxy-2,2-dimethylhept-5-enamide (PubChem CID 88661269) has the molecular formula C23H41NO4 and a molecular weight of 395.58 g/mol. Its IUPAC name is (Z)-7-[(1S,2S,3R,4R)-3-(2-hexoxyethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]-N-hydroxy-2,2-dimethylhept-5-enamide.
| Compound Name | (Z)-7-[(1S,2S,3R,4R)-3-(2-hexoxyethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]-N-hydroxy-2,2-dimethylhept-5-enamide |
|---|---|
| PubChem CID | 88661269 |
| Molecular Formula | C23H41NO4 |
| Molecular Weight | 395.58 g/mol |
| Exact Mass | 395.30 |
| IUPAC Name | (Z)-7-[(1S,2S,3R,4R)-3-(2-hexoxyethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]-N-hydroxy-2,2-dimethylhept-5-enamide |
| SMILES | CCCCCCOCC[C@@H]1[C@H](C/C=C\CCC(C)(C)C(=O)NO)[C@@H]2CC[C@H]1O2 |
| InChI | InChI=1S/C23H41NO4/c1-4-5-6-10-16-27-17-14-19-18(20-12-13-21(19)28-20)11-8-7-9-15-23(2,3)22(25)24-26/h7-8,18-21,26H,4-6,9-17H2,1-3H3,(H,24,25)/b8-7-/t18-,19+,20-,21+/m0/s1 |
| InChIKey | JCOVCFFAYQDNSM-GEFQZONNSA-N |
| XLogP | 5.03 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.58 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|