C29H43NO5 — CID 88661234
[[(Z)-7-[(1S,2S,3S,4R)-3-(hexoxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]-2,2-dimethylhept-5-enoyl]amino] benzoate (PubChem CID 88661234) has the molecular formula C29H43NO5 and a molecular weight of 485.67 g/mol. Its IUPAC name is [[(Z)-7-[(1S,2S,3S,4R)-3-(hexoxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]-2,2-dimethylhept-5-enoyl]amino] benzoate.
| Compound Name | [[(Z)-7-[(1S,2S,3S,4R)-3-(hexoxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]-2,2-dimethylhept-5-enoyl]amino] benzoate |
|---|---|
| PubChem CID | 88661234 |
| Molecular Formula | C29H43NO5 |
| Molecular Weight | 485.67 g/mol |
| Exact Mass | 485.31 |
| IUPAC Name | [[(Z)-7-[(1S,2S,3S,4R)-3-(hexoxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]-2,2-dimethylhept-5-enoyl]amino] benzoate |
| SMILES | CCCCCCOC[C@@H]1[C@H](C/C=C\CCC(C)(C)C(=O)NOC(=O)c2ccccc2)[C@@H]2CC[C@H]1O2 |
| InChI | InChI=1S/C29H43NO5/c1-4-5-6-13-20-33-21-24-23(25-17-18-26(24)34-25)16-11-8-12-19-29(2,3)28(32)30-35-27(31)22-14-9-7-10-15-22/h7-11,14-15,23-26H,4-6,12-13,16-21H2,1-3H3,(H,30,32)/b11-8-/t23-,24+,25-,26+/m0/s1 |
| InChIKey | VZRXZJVFKCNQIL-NKZHBVDOSA-N |
| XLogP | 6.02 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.67 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|