C25H45NO3S — CID 54203425
N-hydroxy-N,2,2-trimethyl-7-[(1S,2S,3R,4R)-3-(octylsulfanylmethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enamide (PubChem CID 54203425) has the molecular formula C25H45NO3S and a molecular weight of 439.71 g/mol. Its IUPAC name is N-hydroxy-N,2,2-trimethyl-7-[(1S,2S,3R,4R)-3-(octylsulfanylmethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enamide.
| Compound Name | N-hydroxy-N,2,2-trimethyl-7-[(1S,2S,3R,4R)-3-(octylsulfanylmethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enamide |
|---|---|
| PubChem CID | 54203425 |
| Molecular Formula | C25H45NO3S |
| Molecular Weight | 439.71 g/mol |
| Exact Mass | 439.31 |
| IUPAC Name | N-hydroxy-N,2,2-trimethyl-7-[(1S,2S,3R,4R)-3-(octylsulfanylmethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enamide |
| SMILES | CCCCCCCCSC[C@@H]1[C@H](CC=CCCC(C)(C)C(=O)N(C)O)[C@@H]2CC[C@H]1O2 |
| InChI | InChI=1S/C25H45NO3S/c1-5-6-7-8-9-13-18-30-19-21-20(22-15-16-23(21)29-22)14-11-10-12-17-25(2,3)24(27)26(4)28/h10-11,20-23,28H,5-9,12-19H2,1-4H3/t20-,21+,22-,23+/m0/s1 |
| InChIKey | PQVGKMNVCZOJAF-GSPCLOLRSA-N |
| XLogP | 6.47 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.71 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|