C23H39N3O5 — CID 88655187
N'-[[(1S,2R,3R,4R)-3-[(Z)-7-[hydroxy(methyl)amino]-7-oxohept-2-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]methyl]-N-pentylpropanediamide (PubChem CID 88655187) has the molecular formula C23H39N3O5 and a molecular weight of 437.58 g/mol. Its IUPAC name is N'-[[(1S,2R,3R,4R)-3-[(Z)-7-[hydroxy(methyl)amino]-7-oxohept-2-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]methyl]-N-pentylpropanediamide.
| Compound Name | N'-[[(1S,2R,3R,4R)-3-[(Z)-7-[hydroxy(methyl)amino]-7-oxohept-2-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]methyl]-N-pentylpropanediamide |
|---|---|
| PubChem CID | 88655187 |
| Molecular Formula | C23H39N3O5 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.29 |
| IUPAC Name | N'-[[(1S,2R,3R,4R)-3-[(Z)-7-[hydroxy(methyl)amino]-7-oxohept-2-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]methyl]-N-pentylpropanediamide |
| SMILES | CCCCCNC(=O)CC(=O)NC[C@H]1[C@@H](C/C=C\CCCC(=O)N(C)O)[C@H]2CC[C@@H]1O2 |
| InChI | InChI=1S/C23H39N3O5/c1-3-4-9-14-24-21(27)15-22(28)25-16-18-17(19-12-13-20(18)31-19)10-7-5-6-8-11-23(29)26(2)30/h5,7,17-20,30H,3-4,6,8-16H2,1-2H3,(H,24,27)(H,25,28)/b7-5-/t17-,18+,19-,20+/m1/s1 |
| InChIKey | DCICJBYHDHUDGC-XWVXKGBWSA-N |
| XLogP | 2.56 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|