C24H42N2O6S — CID 70466696
(Z)-7-[(1R,2R,3S,4S)-3-[4-[[2-(pentylsulfonylamino)acetyl]amino]butyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid (PubChem CID 70466696) has the molecular formula C24H42N2O6S and a molecular weight of 486.68 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3S,4S)-3-[4-[[2-(pentylsulfonylamino)acetyl]amino]butyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,3S,4S)-3-[4-[[2-(pentylsulfonylamino)acetyl]amino]butyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70466696 |
| Molecular Formula | C24H42N2O6S |
| Molecular Weight | 486.68 g/mol |
| Exact Mass | 486.28 |
| IUPAC Name | (Z)-7-[(1R,2R,3S,4S)-3-[4-[[2-(pentylsulfonylamino)acetyl]amino]butyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
| SMILES | CCCCCS(=O)(=O)NCC(=O)NCCCC[C@H]1[C@@H](C/C=C\CCCC(=O)O)[C@H]2CC[C@@H]1O2 |
| InChI | InChI=1S/C24H42N2O6S/c1-2-3-10-17-33(30,31)26-18-23(27)25-16-9-8-12-20-19(21-14-15-22(20)32-21)11-6-4-5-7-13-24(28)29/h4,6,19-22,26H,2-3,5,7-18H2,1H3,(H,25,27)(H,28,29)/b6-4-/t19-,20+,21-,22+/m1/s1 |
| InChIKey | PEOPDRNEKBHSMU-AYYFERJSSA-N |
| XLogP | 3.38 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.68 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|