C22H37NO4S — CID 88703109
(Z)-7-[(1R,2R,3S,4S)-3-[4-(butylcarbamothioyloxy)butyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid (PubChem CID 88703109) has the molecular formula C22H37NO4S and a molecular weight of 411.61 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3S,4S)-3-[4-(butylcarbamothioyloxy)butyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,3S,4S)-3-[4-(butylcarbamothioyloxy)butyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 88703109 |
| Molecular Formula | C22H37NO4S |
| Molecular Weight | 411.61 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | (Z)-7-[(1R,2R,3S,4S)-3-[4-(butylcarbamothioyloxy)butyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
| SMILES | CCCCNC(=S)OCCCC[C@H]1[C@@H](C/C=C\CCCC(=O)O)[C@H]2CC[C@@H]1O2 |
| InChI | InChI=1S/C22H37NO4S/c1-2-3-15-23-22(28)26-16-9-8-11-18-17(19-13-14-20(18)27-19)10-6-4-5-7-12-21(24)25/h4,6,17-20H,2-3,5,7-16H2,1H3,(H,23,28)(H,24,25)/b6-4-/t17-,18+,19-,20+/m1/s1 |
| InChIKey | AKTGAAJYKFXDOP-DSEQFTDHSA-N |
| XLogP | 4.84 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.61 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|