C19H30N2O5 — CID 54227821
7-[(1R,2R,3S,4S)-3-[2-[[2-(ethylamino)-2-oxoacetyl]amino]ethyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid (PubChem CID 54227821) has the molecular formula C19H30N2O5 and a molecular weight of 366.46 g/mol. Its IUPAC name is 7-[(1R,2R,3S,4S)-3-[2-[[2-(ethylamino)-2-oxoacetyl]amino]ethyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2R,3S,4S)-3-[2-[[2-(ethylamino)-2-oxoacetyl]amino]ethyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 54227821 |
| Molecular Formula | C19H30N2O5 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | 7-[(1R,2R,3S,4S)-3-[2-[[2-(ethylamino)-2-oxoacetyl]amino]ethyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
| SMILES | CCNC(=O)C(=O)NCC[C@H]1[C@@H](CC=CCCCC(=O)O)[C@H]2CC[C@@H]1O2 |
| InChI | InChI=1S/C19H30N2O5/c1-2-20-18(24)19(25)21-12-11-14-13(15-9-10-16(14)26-15)7-5-3-4-6-8-17(22)23/h3,5,13-16H,2,4,6-12H2,1H3,(H,20,24)(H,21,25)(H,22,23)/t13-,14+,15-,16+/m1/s1 |
| InChIKey | QHCHHTOJCOOEOO-QXSJWSMHSA-N |
| XLogP | 1.62 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|