C22H38O5S — CID 70508809
(Z)-7-[(1R,2R,3S,4S)-3-(4-pentylsulfonylbutyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid (PubChem CID 70508809) has the molecular formula C22H38O5S and a molecular weight of 414.61 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3S,4S)-3-(4-pentylsulfonylbutyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,3S,4S)-3-(4-pentylsulfonylbutyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70508809 |
| Molecular Formula | C22H38O5S |
| Molecular Weight | 414.61 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | (Z)-7-[(1R,2R,3S,4S)-3-(4-pentylsulfonylbutyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
| SMILES | CCCCCS(=O)(=O)CCCC[C@H]1[C@@H](C/C=C\CCCC(=O)O)[C@H]2CC[C@@H]1O2 |
| InChI | InChI=1S/C22H38O5S/c1-2-3-9-16-28(25,26)17-10-8-12-19-18(20-14-15-21(19)27-20)11-6-4-5-7-13-22(23)24/h4,6,18-21H,2-3,5,7-17H2,1H3,(H,23,24)/b6-4-/t18-,19+,20-,21+/m1/s1 |
| InChIKey | AJAUGPCCSXQPCA-PADVOFEOSA-N |
| XLogP | 4.76 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.61 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|