C22H38N2O6S — CID 70466706
(Z)-7-[(1R,2R,3R,4S)-3-[[2-(pentylsulfonylamino)propanoylamino]methyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid (PubChem CID 70466706) has the molecular formula C22H38N2O6S and a molecular weight of 458.62 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3R,4S)-3-[[2-(pentylsulfonylamino)propanoylamino]methyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,3R,4S)-3-[[2-(pentylsulfonylamino)propanoylamino]methyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70466706 |
| Molecular Formula | C22H38N2O6S |
| Molecular Weight | 458.62 g/mol |
| Exact Mass | 458.25 |
| IUPAC Name | (Z)-7-[(1R,2R,3R,4S)-3-[[2-(pentylsulfonylamino)propanoylamino]methyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
| SMILES | CCCCCS(=O)(=O)NC(C)C(=O)NC[C@H]1[C@@H](C/C=C\CCCC(=O)O)[C@H]2CC[C@@H]1O2 |
| InChI | InChI=1S/C22H38N2O6S/c1-3-4-9-14-31(28,29)24-16(2)22(27)23-15-18-17(19-12-13-20(18)30-19)10-7-5-6-8-11-21(25)26/h5,7,16-20,24H,3-4,6,8-15H2,1-2H3,(H,23,27)(H,25,26)/b7-5-/t16?,17-,18+,19-,20+/m1/s1 |
| InChIKey | MYWRKCYCCXWYRG-ROPBMYPSSA-N |
| XLogP | 2.60 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.62 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|