C23H38N2O4S — CID 14885216
(E)-7-[3-[[[2-(heptanethioylamino)acetyl]amino]methyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid (PubChem CID 14885216) has the molecular formula C23H38N2O4S and a molecular weight of 438.63 g/mol. Its IUPAC name is (E)-7-[3-[[[2-(heptanethioylamino)acetyl]amino]methyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid.
| Compound Name | (E)-7-[3-[[[2-(heptanethioylamino)acetyl]amino]methyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 14885216 |
| Molecular Formula | C23H38N2O4S |
| Molecular Weight | 438.63 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | (E)-7-[3-[[[2-(heptanethioylamino)acetyl]amino]methyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
| SMILES | CCCCCCC(=S)NCC(=O)NCC1C2CCC(O2)C1C/C=C/CCCC(=O)O |
| InChI | InChI=1S/C23H38N2O4S/c1-2-3-4-8-11-22(30)25-16-21(26)24-15-18-17(19-13-14-20(18)29-19)10-7-5-6-9-12-23(27)28/h5,7,17-20H,2-4,6,8-16H2,1H3,(H,24,26)(H,25,30)(H,27,28)/b7-5+ |
| InChIKey | HRDSTLFKRWABMM-FNORWQNLSA-N |
| XLogP | 3.98 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.63 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|