C23H40N2O4S — CID 57186056
7-[(1R,2R,3S,4S)-3-[2-[[2-(hexanethioylamino)acetyl]amino]ethyl]-7-oxabicyclo[2.2.1]heptan-2-yl]heptanoic acid (PubChem CID 57186056) has the molecular formula C23H40N2O4S and a molecular weight of 440.65 g/mol. Its IUPAC name is 7-[(1R,2R,3S,4S)-3-[2-[[2-(hexanethioylamino)acetyl]amino]ethyl]-7-oxabicyclo[2.2.1]heptan-2-yl]heptanoic acid.
| Compound Name | 7-[(1R,2R,3S,4S)-3-[2-[[2-(hexanethioylamino)acetyl]amino]ethyl]-7-oxabicyclo[2.2.1]heptan-2-yl]heptanoic acid |
|---|---|
| PubChem CID | 57186056 |
| Molecular Formula | C23H40N2O4S |
| Molecular Weight | 440.65 g/mol |
| Exact Mass | 440.27 |
| IUPAC Name | 7-[(1R,2R,3S,4S)-3-[2-[[2-(hexanethioylamino)acetyl]amino]ethyl]-7-oxabicyclo[2.2.1]heptan-2-yl]heptanoic acid |
| SMILES | CCCCCC(=S)NCC(=O)NCC[C@H]1[C@@H](CCCCCCC(=O)O)[C@H]2CC[C@@H]1O2 |
| InChI | InChI=1S/C23H40N2O4S/c1-2-3-6-10-22(30)25-16-21(26)24-15-14-18-17(19-12-13-20(18)29-19)9-7-4-5-8-11-23(27)28/h17-20H,2-16H2,1H3,(H,24,26)(H,25,30)(H,27,28)/t17-,18+,19-,20+/m1/s1 |
| InChIKey | YXWFIHVAIYJDAO-WCIQWLHISA-N |
| XLogP | 4.21 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.65 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|