C25H42N2O4S — CID 70408662
(Z)-7-[(1R,2R,3S,4S)-3-[4-[[2-(hexanoylamino)acetyl]amino]butyl]-7-thiabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid (PubChem CID 70408662) has the molecular formula C25H42N2O4S and a molecular weight of 466.69 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3S,4S)-3-[4-[[2-(hexanoylamino)acetyl]amino]butyl]-7-thiabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,3S,4S)-3-[4-[[2-(hexanoylamino)acetyl]amino]butyl]-7-thiabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70408662 |
| Molecular Formula | C25H42N2O4S |
| Molecular Weight | 466.69 g/mol |
| Exact Mass | 466.29 |
| IUPAC Name | (Z)-7-[(1R,2R,3S,4S)-3-[4-[[2-(hexanoylamino)acetyl]amino]butyl]-7-thiabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
| SMILES | CCCCCC(=O)NCC(=O)NCCCC[C@H]1[C@@H](C/C=C\CCCC(=O)O)[C@H]2CC[C@@H]1S2 |
| InChI | InChI=1S/C25H42N2O4S/c1-2-3-6-13-23(28)27-18-24(29)26-17-10-9-12-20-19(21-15-16-22(20)32-21)11-7-4-5-8-14-25(30)31/h4,7,19-22H,2-3,5-6,8-18H2,1H3,(H,26,29)(H,27,28)(H,30,31)/b7-4-/t19-,20+,21-,22+/m1/s1 |
| InChIKey | FNGCHOLZBWUYQQ-QQWVFNMNSA-N |
| XLogP | 4.68 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.69 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|