C24H40N2O4S — CID 54188926
7-[(1R,2R,3R,4S)-3-[[[2-(hexanoylamino)-2-methylpropanoyl]amino]methyl]-7-thiabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid (PubChem CID 54188926) has the molecular formula C24H40N2O4S and a molecular weight of 452.66 g/mol. Its IUPAC name is 7-[(1R,2R,3R,4S)-3-[[[2-(hexanoylamino)-2-methylpropanoyl]amino]methyl]-7-thiabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2R,3R,4S)-3-[[[2-(hexanoylamino)-2-methylpropanoyl]amino]methyl]-7-thiabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 54188926 |
| Molecular Formula | C24H40N2O4S |
| Molecular Weight | 452.66 g/mol |
| Exact Mass | 452.27 |
| IUPAC Name | 7-[(1R,2R,3R,4S)-3-[[[2-(hexanoylamino)-2-methylpropanoyl]amino]methyl]-7-thiabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
| SMILES | CCCCCC(=O)NC(C)(C)C(=O)NC[C@H]1[C@@H](CC=CCCCC(=O)O)[C@H]2CC[C@@H]1S2 |
| InChI | InChI=1S/C24H40N2O4S/c1-4-5-8-12-21(27)26-24(2,3)23(30)25-16-18-17(19-14-15-20(18)31-19)11-9-6-7-10-13-22(28)29/h6,9,17-20H,4-5,7-8,10-16H2,1-3H3,(H,25,30)(H,26,27)(H,28,29)/t17-,18+,19-,20+/m1/s1 |
| InChIKey | PHCULVHGPSGBSV-WCIQWLHISA-N |
| XLogP | 4.29 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.66 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|