C20H34O4S2 — CID 70470364
(Z)-7-[(1R,2R,3R,4S)-3-(hexylsulfonylmethyl)-7-thiabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid (PubChem CID 70470364) has the molecular formula C20H34O4S2 and a molecular weight of 402.62 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3R,4S)-3-(hexylsulfonylmethyl)-7-thiabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,3R,4S)-3-(hexylsulfonylmethyl)-7-thiabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70470364 |
| Molecular Formula | C20H34O4S2 |
| Molecular Weight | 402.62 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | (Z)-7-[(1R,2R,3R,4S)-3-(hexylsulfonylmethyl)-7-thiabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
| SMILES | CCCCCCS(=O)(=O)C[C@H]1[C@@H](C/C=C\CCCC(=O)O)[C@H]2CC[C@@H]1S2 |
| InChI | InChI=1S/C20H34O4S2/c1-2-3-4-9-14-26(23,24)15-17-16(18-12-13-19(17)25-18)10-7-5-6-8-11-20(21)22/h5,7,16-19H,2-4,6,8-15H2,1H3,(H,21,22)/b7-5-/t16-,17+,18-,19+/m1/s1 |
| InChIKey | NRMIQLUZMDNCGW-YXEGLXKCSA-N |
| XLogP | 4.69 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.62 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|