C21H32O3S — CID 57032502
7-[(1S,2S,3S,4R)-3-(3-oxooct-1-enyl)-7-thiabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid (PubChem CID 57032502) has the molecular formula C21H32O3S and a molecular weight of 364.55 g/mol. Its IUPAC name is 7-[(1S,2S,3S,4R)-3-(3-oxooct-1-enyl)-7-thiabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid.
| Compound Name | 7-[(1S,2S,3S,4R)-3-(3-oxooct-1-enyl)-7-thiabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 57032502 |
| Molecular Formula | C21H32O3S |
| Molecular Weight | 364.55 g/mol |
| Exact Mass | 364.21 |
| IUPAC Name | 7-[(1S,2S,3S,4R)-3-(3-oxooct-1-enyl)-7-thiabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
| SMILES | CCCCCC(=O)C=C[C@H]1[C@H](CC=CCCCC(=O)O)[C@@H]2CC[C@H]1S2 |
| InChI | InChI=1S/C21H32O3S/c1-2-3-6-9-16(22)12-13-18-17(19-14-15-20(18)25-19)10-7-4-5-8-11-21(23)24/h4,7,12-13,17-20H,2-3,5-6,8-11,14-15H2,1H3,(H,23,24)/t17-,18-,19-,20+/m0/s1 |
| InChIKey | UIKRUEMNMJTSOT-LWYYNNOASA-N |
| XLogP | 5.40 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.55 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|