C23H36O3S — CID 54296282
7-[(1R,2R,3S,4S)-3-[3-hydroxy-3-(1-methylcyclohexyl)prop-1-enyl]-7-thiabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid (PubChem CID 54296282) has the molecular formula C23H36O3S and a molecular weight of 392.61 g/mol. Its IUPAC name is 7-[(1R,2R,3S,4S)-3-[3-hydroxy-3-(1-methylcyclohexyl)prop-1-enyl]-7-thiabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2R,3S,4S)-3-[3-hydroxy-3-(1-methylcyclohexyl)prop-1-enyl]-7-thiabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 54296282 |
| Molecular Formula | C23H36O3S |
| Molecular Weight | 392.61 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | 7-[(1R,2R,3S,4S)-3-[3-hydroxy-3-(1-methylcyclohexyl)prop-1-enyl]-7-thiabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
| SMILES | CC1(C(O)C=C[C@H]2[C@@H](CC=CCCCC(=O)O)[C@H]3CC[C@@H]2S3)CCCCC1 |
| InChI | InChI=1S/C23H36O3S/c1-23(15-7-4-8-16-23)21(24)14-11-18-17(19-12-13-20(18)27-19)9-5-2-3-6-10-22(25)26/h2,5,11,14,17-21,24H,3-4,6-10,12-13,15-16H2,1H3,(H,25,26)/t17-,18+,19-,20+,21?/m1/s1 |
| InChIKey | SAZUWCRDFXZAEG-DQKSBWHRSA-N |
| XLogP | 5.59 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.61 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|