C23H38O2S2 — CID 70353113
(Z)-7-[(1R,2R,3S,4S)-3-(4-cyclohexylsulfanylbutyl)-7-thiabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid (PubChem CID 70353113) has the molecular formula C23H38O2S2 and a molecular weight of 410.69 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3S,4S)-3-(4-cyclohexylsulfanylbutyl)-7-thiabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,3S,4S)-3-(4-cyclohexylsulfanylbutyl)-7-thiabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70353113 |
| Molecular Formula | C23H38O2S2 |
| Molecular Weight | 410.69 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | (Z)-7-[(1R,2R,3S,4S)-3-(4-cyclohexylsulfanylbutyl)-7-thiabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\C[C@@H]1[C@H](CCCCSC2CCCCC2)[C@@H]2CC[C@H]1S2 |
| InChI | InChI=1S/C23H38O2S2/c24-23(25)14-7-2-1-6-12-19-20(22-16-15-21(19)27-22)13-8-9-17-26-18-10-4-3-5-11-18/h1,6,18-22H,2-5,7-17H2,(H,24,25)/b6-1-/t19-,20+,21-,22+/m1/s1 |
| InChIKey | VPOYMERFGQOKCL-ZQGYEFITSA-N |
| XLogP | 6.93 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.69 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|