C22H36N2O3S2 — CID 88642409
(Z)-7-[(1R,2R,3R,4S)-3-[[[2-(hexanethioylamino)acetyl]amino]methyl]-7-thiabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid (PubChem CID 88642409) has the molecular formula C22H36N2O3S2 and a molecular weight of 440.68 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3R,4S)-3-[[[2-(hexanethioylamino)acetyl]amino]methyl]-7-thiabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,3R,4S)-3-[[[2-(hexanethioylamino)acetyl]amino]methyl]-7-thiabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 88642409 |
| Molecular Formula | C22H36N2O3S2 |
| Molecular Weight | 440.68 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | (Z)-7-[(1R,2R,3R,4S)-3-[[[2-(hexanethioylamino)acetyl]amino]methyl]-7-thiabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
| SMILES | CCCCCC(=S)NCC(=O)NC[C@H]1[C@@H](C/C=C\CCCC(=O)O)[C@H]2CC[C@@H]1S2 |
| InChI | InChI=1S/C22H36N2O3S2/c1-2-3-6-10-21(28)24-15-20(25)23-14-17-16(18-12-13-19(17)29-18)9-7-4-5-8-11-22(26)27/h4,7,16-19H,2-3,5-6,8-15H2,1H3,(H,23,25)(H,24,28)(H,26,27)/b7-4-/t16-,17+,18-,19+/m1/s1 |
| InChIKey | FYZDNKBYCXMNOV-DSIUVCIOSA-N |
| XLogP | 4.31 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.68 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|