C27H38N2O4S — CID 70407943
(Z)-7-[(1S,2S,3S,4R)-3-[[[2-(5-phenylpentanoylamino)acetyl]amino]methyl]-7-thiabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid (PubChem CID 70407943) has the molecular formula C27H38N2O4S and a molecular weight of 486.68 g/mol. Its IUPAC name is (Z)-7-[(1S,2S,3S,4R)-3-[[[2-(5-phenylpentanoylamino)acetyl]amino]methyl]-7-thiabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1S,2S,3S,4R)-3-[[[2-(5-phenylpentanoylamino)acetyl]amino]methyl]-7-thiabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70407943 |
| Molecular Formula | C27H38N2O4S |
| Molecular Weight | 486.68 g/mol |
| Exact Mass | 486.26 |
| IUPAC Name | (Z)-7-[(1S,2S,3S,4R)-3-[[[2-(5-phenylpentanoylamino)acetyl]amino]methyl]-7-thiabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\C[C@H]1[C@@H](CNC(=O)CNC(=O)CCCCc2ccccc2)[C@H]2CC[C@@H]1S2 |
| InChI | InChI=1S/C27H38N2O4S/c30-25(14-9-8-12-20-10-4-3-5-11-20)29-19-26(31)28-18-22-21(23-16-17-24(22)34-23)13-6-1-2-7-15-27(32)33/h1,3-6,10-11,21-24H,2,7-9,12-19H2,(H,28,31)(H,29,30)(H,32,33)/b6-1-/t21-,22+,23-,24+/m0/s1 |
| InChIKey | AZPYLOXXEWBCDG-ZDJVEULPSA-N |
| XLogP | 4.34 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.68 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|