C26H34N2O6 — CID 57088807
7-[(1S,2S,3R,4R)-3-[[[2-[3-(4-hydroxyphenyl)propanoylamino]acetyl]amino]methyl]-7-oxo-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid (PubChem CID 57088807) has the molecular formula C26H34N2O6 and a molecular weight of 470.57 g/mol. Its IUPAC name is 7-[(1S,2S,3R,4R)-3-[[[2-[3-(4-hydroxyphenyl)propanoylamino]acetyl]amino]methyl]-7-oxo-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid.
| Compound Name | 7-[(1S,2S,3R,4R)-3-[[[2-[3-(4-hydroxyphenyl)propanoylamino]acetyl]amino]methyl]-7-oxo-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 57088807 |
| Molecular Formula | C26H34N2O6 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.24 |
| IUPAC Name | 7-[(1S,2S,3R,4R)-3-[[[2-[3-(4-hydroxyphenyl)propanoylamino]acetyl]amino]methyl]-7-oxo-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid |
| SMILES | O=C(O)CCCC=CC[C@H]1[C@@H](CNC(=O)CNC(=O)CCc2ccc(O)cc2)[C@H]2CC[C@@H]1C2=O |
| InChI | InChI=1S/C26H34N2O6/c29-18-10-7-17(8-11-18)9-14-23(30)28-16-24(31)27-15-22-19(20-12-13-21(22)26(20)34)5-3-1-2-4-6-25(32)33/h1,3,7-8,10-11,19-22,29H,2,4-6,9,12-16H2,(H,27,31)(H,28,30)(H,32,33)/t19-,20+,21-,22-/m1/s1 |
| InChIKey | IHNZMQJPTLDUGQ-CIAFKFPVSA-N |
| XLogP | 2.60 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|