C27H38N2O4 — CID 70408640
(Z)-7-[(1S,2S,3R,4R)-3-[[3-[benzoyl(ethyl)amino]propanoylamino]methyl]-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid (PubChem CID 70408640) has the molecular formula C27H38N2O4 and a molecular weight of 454.61 g/mol. Its IUPAC name is (Z)-7-[(1S,2S,3R,4R)-3-[[3-[benzoyl(ethyl)amino]propanoylamino]methyl]-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1S,2S,3R,4R)-3-[[3-[benzoyl(ethyl)amino]propanoylamino]methyl]-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70408640 |
| Molecular Formula | C27H38N2O4 |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 454.28 |
| IUPAC Name | (Z)-7-[(1S,2S,3R,4R)-3-[[3-[benzoyl(ethyl)amino]propanoylamino]methyl]-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid |
| SMILES | CCN(CCC(=O)NC[C@@H]1[C@@H]2CC[C@@H](C2)[C@@H]1C/C=C\CCCC(=O)O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C27H38N2O4/c1-2-29(27(33)20-10-6-5-7-11-20)17-16-25(30)28-19-24-22-15-14-21(18-22)23(24)12-8-3-4-9-13-26(31)32/h3,5-8,10-11,21-24H,2,4,9,12-19H2,1H3,(H,28,30)(H,31,32)/b8-3-/t21-,22+,23-,24+/m0/s1 |
| InChIKey | HKQCZQZCIQYMBY-CQUIFEEVSA-N |
| XLogP | 4.52 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|