C20H26O3 — CID 54249380
7-[(1S,2S,3R,4R)-3-phenoxy-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid (PubChem CID 54249380) has the molecular formula C20H26O3 and a molecular weight of 314.43 g/mol. Its IUPAC name is 7-[(1S,2S,3R,4R)-3-phenoxy-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid.
| Compound Name | 7-[(1S,2S,3R,4R)-3-phenoxy-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 54249380 |
| Molecular Formula | C20H26O3 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | 7-[(1S,2S,3R,4R)-3-phenoxy-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid |
| SMILES | O=C(O)CCCC=CC[C@H]1[C@H]2CC[C@H](C2)[C@H]1Oc1ccccc1 |
| InChI | InChI=1S/C20H26O3/c21-19(22)11-7-2-1-6-10-18-15-12-13-16(14-15)20(18)23-17-8-4-3-5-9-17/h1,3-6,8-9,15-16,18,20H,2,7,10-14H2,(H,21,22)/t15-,16+,18-,20+/m0/s1 |
| InChIKey | QVRCITVAQCVLMI-WBQJQJEBSA-N |
| XLogP | 4.68 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|