C27H31NO3 — CID 58697859
(Z)-7-[(1R,2R,3R,4S)-3-[(4-phenylbenzoyl)amino]-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid (PubChem CID 58697859) has the molecular formula C27H31NO3 and a molecular weight of 417.55 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3R,4S)-3-[(4-phenylbenzoyl)amino]-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,3R,4S)-3-[(4-phenylbenzoyl)amino]-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 58697859 |
| Molecular Formula | C27H31NO3 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | (Z)-7-[(1R,2R,3R,4S)-3-[(4-phenylbenzoyl)amino]-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\C[C@@H]1[C@@H]2CC[C@@H](C2)[C@H]1NC(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C27H31NO3/c29-25(30)11-7-2-1-6-10-24-22-16-17-23(18-22)26(24)28-27(31)21-14-12-20(13-15-21)19-8-4-3-5-9-19/h1,3-6,8-9,12-15,22-24,26H,2,7,10-11,16-18H2,(H,28,31)(H,29,30)/b6-1-/t22-,23+,24-,26-/m1/s1 |
| InChIKey | ZBNLHDTZKLXXJV-ODYQMHKDSA-N |
| XLogP | 5.70 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|