C29H35NO3 — CID 11091552
(Z)-7-[(1S,2R,3R,5R)-6,6-dimethyl-3-[(4-phenylbenzoyl)amino]-2-bicyclo[3.1.1]heptanyl]hept-5-enoic acid (PubChem CID 11091552) has the molecular formula C29H35NO3 and a molecular weight of 445.60 g/mol. Its IUPAC name is (Z)-7-[(1S,2R,3R,5R)-6,6-dimethyl-3-[(4-phenylbenzoyl)amino]-2-bicyclo[3.1.1]heptanyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1S,2R,3R,5R)-6,6-dimethyl-3-[(4-phenylbenzoyl)amino]-2-bicyclo[3.1.1]heptanyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 11091552 |
| Molecular Formula | C29H35NO3 |
| Molecular Weight | 445.60 g/mol |
| Exact Mass | 445.26 |
| IUPAC Name | (Z)-7-[(1S,2R,3R,5R)-6,6-dimethyl-3-[(4-phenylbenzoyl)amino]-2-bicyclo[3.1.1]heptanyl]hept-5-enoic acid |
| SMILES | CC1(C)[C@H]2C[C@@H](NC(=O)c3ccc(-c4ccccc4)cc3)[C@H](C/C=C\CCCC(=O)O)[C@@H]1C2 |
| InChI | InChI=1S/C29H35NO3/c1-29(2)23-18-25(29)24(12-8-3-4-9-13-27(31)32)26(19-23)30-28(33)22-16-14-21(15-17-22)20-10-6-5-7-11-20/h3,5-8,10-11,14-17,23-26H,4,9,12-13,18-19H2,1-2H3,(H,30,33)(H,31,32)/b8-3-/t23-,24-,25+,26-/m1/s1 |
| InChIKey | FGTIZCIMMGVKNA-LGOKGUEOSA-N |
| XLogP | 6.34 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.60 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|