C28H33NO3 — CID 58697860
methyl (Z)-7-[(1R,2R,3R,4S)-3-[(4-phenylbenzoyl)amino]-2-bicyclo[2.2.1]heptanyl]hept-5-enoate (PubChem CID 58697860) has the molecular formula C28H33NO3 and a molecular weight of 431.58 g/mol. Its IUPAC name is methyl (Z)-7-[(1R,2R,3R,4S)-3-[(4-phenylbenzoyl)amino]-2-bicyclo[2.2.1]heptanyl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(1R,2R,3R,4S)-3-[(4-phenylbenzoyl)amino]-2-bicyclo[2.2.1]heptanyl]hept-5-enoate |
|---|---|
| PubChem CID | 58697860 |
| Molecular Formula | C28H33NO3 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.25 |
| IUPAC Name | methyl (Z)-7-[(1R,2R,3R,4S)-3-[(4-phenylbenzoyl)amino]-2-bicyclo[2.2.1]heptanyl]hept-5-enoate |
| SMILES | COC(=O)CCC/C=C\C[C@@H]1[C@@H]2CC[C@@H](C2)[C@H]1NC(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C28H33NO3/c1-32-26(30)12-8-3-2-7-11-25-23-17-18-24(19-23)27(25)29-28(31)22-15-13-21(14-16-22)20-9-5-4-6-10-20/h2,4-7,9-10,13-16,23-25,27H,3,8,11-12,17-19H2,1H3,(H,29,31)/b7-2-/t23-,24+,25-,27-/m1/s1 |
| InChIKey | HZMMAESXPUKEQG-QKNUJFJRSA-N |
| XLogP | 5.79 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|