C24H37NO3 — CID 90434779
methyl (Z)-7-[(1R,2R,3R,5S)-3-amino-5-hydroxy-2-(5-phenylpentyl)cyclopentyl]hept-5-enoate (PubChem CID 90434779) has the molecular formula C24H37NO3 and a molecular weight of 387.56 g/mol. Its IUPAC name is methyl (Z)-7-[(1R,2R,3R,5S)-3-amino-5-hydroxy-2-(5-phenylpentyl)cyclopentyl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(1R,2R,3R,5S)-3-amino-5-hydroxy-2-(5-phenylpentyl)cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 90434779 |
| Molecular Formula | C24H37NO3 |
| Molecular Weight | 387.56 g/mol |
| Exact Mass | 387.28 |
| IUPAC Name | methyl (Z)-7-[(1R,2R,3R,5S)-3-amino-5-hydroxy-2-(5-phenylpentyl)cyclopentyl]hept-5-enoate |
| SMILES | COC(=O)CCC/C=C\C[C@@H]1[C@@H](CCCCCc2ccccc2)[C@H](N)C[C@@H]1O |
| InChI | InChI=1S/C24H37NO3/c1-28-24(27)17-11-3-2-9-16-21-20(22(25)18-23(21)26)15-10-5-8-14-19-12-6-4-7-13-19/h2,4,6-7,9,12-13,20-23,26H,3,5,8,10-11,14-18,25H2,1H3/b9-2-/t20-,21-,22-,23+/m1/s1 |
| InChIKey | GXTZYDPKYUOGGV-XPZPSUPZSA-N |
| XLogP | 4.40 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.56 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|