C25H36O2 — CID 91200848
4-methyl-2-(7-oxooct-2-enyl)-3-(5-phenylpentyl)cyclopentan-1-one (PubChem CID 91200848) has the molecular formula C25H36O2 and a molecular weight of 368.56 g/mol. Its IUPAC name is 4-methyl-2-(7-oxooct-2-enyl)-3-(5-phenylpentyl)cyclopentan-1-one.
| Compound Name | 4-methyl-2-(7-oxooct-2-enyl)-3-(5-phenylpentyl)cyclopentan-1-one |
|---|---|
| PubChem CID | 91200848 |
| Molecular Formula | C25H36O2 |
| Molecular Weight | 368.56 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | 4-methyl-2-(7-oxooct-2-enyl)-3-(5-phenylpentyl)cyclopentan-1-one |
| SMILES | CC(=O)CCCC=CCC1C(=O)CC(C)C1CCCCCc1ccccc1 |
| InChI | InChI=1S/C25H36O2/c1-20-19-25(27)24(18-11-4-3-7-13-21(2)26)23(20)17-12-6-10-16-22-14-8-5-9-15-22/h4-5,8-9,11,14-15,20,23-24H,3,6-7,10,12-13,16-19H2,1-2H3 |
| InChIKey | PALNSINQGWIMIF-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.56 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|