C20H26O5 — CID 67527532
methyl 7-[(1R,2S,3R)-3-hydroxy-5-oxo-2-(phenoxymethyl)cyclopentyl]hept-5-enoate (PubChem CID 67527532) has the molecular formula C20H26O5 and a molecular weight of 346.42 g/mol. Its IUPAC name is methyl 7-[(1R,2S,3R)-3-hydroxy-5-oxo-2-(phenoxymethyl)cyclopentyl]hept-5-enoate.
| Compound Name | methyl 7-[(1R,2S,3R)-3-hydroxy-5-oxo-2-(phenoxymethyl)cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 67527532 |
| Molecular Formula | C20H26O5 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | methyl 7-[(1R,2S,3R)-3-hydroxy-5-oxo-2-(phenoxymethyl)cyclopentyl]hept-5-enoate |
| SMILES | COC(=O)CCCC=CC[C@H]1C(=O)C[C@@H](O)[C@@H]1COc1ccccc1 |
| InChI | InChI=1S/C20H26O5/c1-24-20(23)12-8-3-2-7-11-16-17(19(22)13-18(16)21)14-25-15-9-5-4-6-10-15/h2,4-7,9-10,16-17,19,22H,3,8,11-14H2,1H3/t16-,17-,19-/m1/s1 |
| InChIKey | LCAUWKPDKDJTJZ-ZHALLVOQSA-N |
| XLogP | 2.92 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|