C25H44O5S — CID 70590110
methyl 7-[(1S,2R)-3-hydroxy-2-(2-hydroxy-2-pentylheptyl)sulfanyl-5-oxocyclopentyl]hept-5-enoate (PubChem CID 70590110) has the molecular formula C25H44O5S and a molecular weight of 456.69 g/mol. Its IUPAC name is methyl 7-[(1S,2R)-3-hydroxy-2-(2-hydroxy-2-pentylheptyl)sulfanyl-5-oxocyclopentyl]hept-5-enoate.
| Compound Name | methyl 7-[(1S,2R)-3-hydroxy-2-(2-hydroxy-2-pentylheptyl)sulfanyl-5-oxocyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 70590110 |
| Molecular Formula | C25H44O5S |
| Molecular Weight | 456.69 g/mol |
| Exact Mass | 456.29 |
| IUPAC Name | methyl 7-[(1S,2R)-3-hydroxy-2-(2-hydroxy-2-pentylheptyl)sulfanyl-5-oxocyclopentyl]hept-5-enoate |
| SMILES | CCCCCC(O)(CCCCC)CS[C@H]1C(O)CC(=O)[C@@H]1CC=CCCCC(=O)OC |
| InChI | InChI=1S/C25H44O5S/c1-4-6-12-16-25(29,17-13-7-5-2)19-31-24-20(21(26)18-22(24)27)14-10-8-9-11-15-23(28)30-3/h8,10,20,22,24,27,29H,4-7,9,11-19H2,1-3H3/t20-,22?,24+/m0/s1 |
| InChIKey | SAPDAVFLQHUVOO-BRGACJNDSA-N |
| XLogP | 5.22 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.69 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|