C29H35NO8 — CID 70377877
(4-acetamidophenyl) (Z)-7-[(1R,2R,3R)-3-hydroxy-2-(2-hydroxy-3-phenoxypropoxy)-5-oxocyclopentyl]hept-5-enoate (PubChem CID 70377877) has the molecular formula C29H35NO8 and a molecular weight of 525.60 g/mol. Its IUPAC name is (4-acetamidophenyl) (Z)-7-[(1R,2R,3R)-3-hydroxy-2-(2-hydroxy-3-phenoxypropoxy)-5-oxocyclopentyl]hept-5-enoate.
| Compound Name | (4-acetamidophenyl) (Z)-7-[(1R,2R,3R)-3-hydroxy-2-(2-hydroxy-3-phenoxypropoxy)-5-oxocyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 70377877 |
| Molecular Formula | C29H35NO8 |
| Molecular Weight | 525.60 g/mol |
| Exact Mass | 525.24 |
| IUPAC Name | (4-acetamidophenyl) (Z)-7-[(1R,2R,3R)-3-hydroxy-2-(2-hydroxy-3-phenoxypropoxy)-5-oxocyclopentyl]hept-5-enoate |
| SMILES | CC(=O)Nc1ccc(OC(=O)CCC/C=C\C[C@H]2C(=O)C[C@@H](O)[C@@H]2OCC(O)COc2ccccc2)cc1 |
| InChI | InChI=1S/C29H35NO8/c1-20(31)30-21-13-15-24(16-14-21)38-28(35)12-8-3-2-7-11-25-26(33)17-27(34)29(25)37-19-22(32)18-36-23-9-5-4-6-10-23/h2,4-7,9-10,13-16,22,25,27,29,32,34H,3,8,11-12,17-19H2,1H3,(H,30,31)/b7-2-/t22?,25-,27+,29+/m0/s1 |
| InChIKey | PDVAXGZWBMTPLS-UMIVNCEXSA-N |
| XLogP | 3.44 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.60 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|