C25H27NO5 — CID 88753959
(4-benzamidophenyl) (E)-7-(3-hydroxy-6-oxabicyclo[3.1.0]hexan-2-yl)hept-5-enoate (PubChem CID 88753959) has the molecular formula C25H27NO5 and a molecular weight of 421.49 g/mol. Its IUPAC name is (4-benzamidophenyl) (E)-7-(3-hydroxy-6-oxabicyclo[3.1.0]hexan-2-yl)hept-5-enoate.
| Compound Name | (4-benzamidophenyl) (E)-7-(3-hydroxy-6-oxabicyclo[3.1.0]hexan-2-yl)hept-5-enoate |
|---|---|
| PubChem CID | 88753959 |
| Molecular Formula | C25H27NO5 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | (4-benzamidophenyl) (E)-7-(3-hydroxy-6-oxabicyclo[3.1.0]hexan-2-yl)hept-5-enoate |
| SMILES | O=C(CCC/C=C/CC1C(O)CC2OC21)Oc1ccc(NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H27NO5/c27-21-16-22-24(31-22)20(21)10-6-1-2-7-11-23(28)30-19-14-12-18(13-15-19)26-25(29)17-8-4-3-5-9-17/h1,3-6,8-9,12-15,20-22,24,27H,2,7,10-11,16H2,(H,26,29)/b6-1+ |
| InChIKey | SBTHUKKYXMMFJI-LZCJLJQNSA-N |
| XLogP | 4.11 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|