C43H38N2O4P+ — CID 88754434
[5-[4-[(4-benzamidobenzoyl)amino]phenoxy]-5-oxopentyl]-triphenylphosphanium (PubChem CID 88754434) has the molecular formula C43H38N2O4P+ and a molecular weight of 677.76 g/mol. Its IUPAC name is [5-[4-[(4-benzamidobenzoyl)amino]phenoxy]-5-oxopentyl]-triphenylphosphanium.
| Compound Name | [5-[4-[(4-benzamidobenzoyl)amino]phenoxy]-5-oxopentyl]-triphenylphosphanium |
|---|---|
| PubChem CID | 88754434 |
| Molecular Formula | C43H38N2O4P+ |
| Molecular Weight | 677.76 g/mol |
| Exact Mass | 677.26 |
| IUPAC Name | [5-[4-[(4-benzamidobenzoyl)amino]phenoxy]-5-oxopentyl]-triphenylphosphanium |
| SMILES | O=C(CCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)Oc1ccc(NC(=O)c2ccc(NC(=O)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C43H37N2O4P/c46-41(23-13-14-32-50(38-17-7-2-8-18-38,39-19-9-3-10-20-39)40-21-11-4-12-22-40)49-37-30-28-36(29-31-37)45-43(48)34-24-26-35(27-25-34)44-42(47)33-15-5-1-6-16-33/h1-12,15-22,24-31H,13-14,23,32H2,(H-,44,45,47,48)/p+1 |
| InChIKey | WHLAOBSGQPDLIC-UHFFFAOYSA-O |
| XLogP | 8.26 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.76 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|