C36H34N2O3P+ — CID 88754013
[5-oxo-5-[4-(phenylcarbamoylamino)phenoxy]pentyl]-triphenylphosphanium (PubChem CID 88754013) has the molecular formula C36H34N2O3P+ and a molecular weight of 573.65 g/mol. Its IUPAC name is [5-oxo-5-[4-(phenylcarbamoylamino)phenoxy]pentyl]-triphenylphosphanium.
| Compound Name | [5-oxo-5-[4-(phenylcarbamoylamino)phenoxy]pentyl]-triphenylphosphanium |
|---|---|
| PubChem CID | 88754013 |
| Molecular Formula | C36H34N2O3P+ |
| Molecular Weight | 573.65 g/mol |
| Exact Mass | 573.23 |
| IUPAC Name | [5-oxo-5-[4-(phenylcarbamoylamino)phenoxy]pentyl]-triphenylphosphanium |
| SMILES | O=C(Nc1ccccc1)Nc1ccc(OC(=O)CCCC[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C36H33N2O3P/c39-35(41-31-26-24-30(25-27-31)38-36(40)37-29-15-5-1-6-16-29)23-13-14-28-42(32-17-7-2-8-18-32,33-19-9-3-10-20-33)34-21-11-4-12-22-34/h1-12,15-22,24-27H,13-14,23,28H2,(H-,37,38,40)/p+1 |
| InChIKey | MNWHBJVXVKYKPM-UHFFFAOYSA-O |
| XLogP | 7.40 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.65 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|