C35H34BrO2PS3 — CID 71549015
[8-oxo-8-[4-(5-sulfanylidenedithiol-3-yl)phenoxy]octyl]-triphenylphosphanium bromide (PubChem CID 71549015) has the molecular formula C35H34BrO2PS3 and a molecular weight of 693.73 g/mol. Its IUPAC name is [8-oxo-8-[4-(5-sulfanylidenedithiol-3-yl)phenoxy]octyl]-triphenylphosphanium bromide.
| Compound Name | [8-oxo-8-[4-(5-sulfanylidenedithiol-3-yl)phenoxy]octyl]-triphenylphosphanium bromide |
|---|---|
| PubChem CID | 71549015 |
| Molecular Formula | C35H34BrO2PS3 |
| Molecular Weight | 693.73 g/mol |
| Exact Mass | 692.06 |
| IUPAC Name | [8-oxo-8-[4-(5-sulfanylidenedithiol-3-yl)phenoxy]octyl]-triphenylphosphanium bromide |
| SMILES | O=C(CCCCCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)Oc1ccc(-c2cc(=S)ss2)cc1.[Br-] |
| InChI | InChI=1S/C35H34O2PS3.BrH/c36-34(37-29-24-22-28(23-25-29)33-27-35(39)41-40-33)21-13-2-1-3-14-26-38(30-15-7-4-8-16-30,31-17-9-5-10-18-31)32-19-11-6-12-20-32;/h4-12,15-20,22-25,27H,1-3,13-14,21,26H2;1H/q+1;/p-1 |
| InChIKey | MIBLOVSOUFZGJQ-UHFFFAOYSA-M |
| XLogP | 6.45 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.73 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|