C20H15NO7S3 — CID 122583362
phenyl 2-(4-nitrooxybutanoyloxy)-4-(5-sulfanylidenedithiol-3-yl)benzoate (PubChem CID 122583362) has the molecular formula C20H15NO7S3 and a molecular weight of 477.54 g/mol. Its IUPAC name is phenyl 2-(4-nitrooxybutanoyloxy)-4-(5-sulfanylidenedithiol-3-yl)benzoate.
| Compound Name | phenyl 2-(4-nitrooxybutanoyloxy)-4-(5-sulfanylidenedithiol-3-yl)benzoate |
|---|---|
| PubChem CID | 122583362 |
| Molecular Formula | C20H15NO7S3 |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.00 |
| IUPAC Name | phenyl 2-(4-nitrooxybutanoyloxy)-4-(5-sulfanylidenedithiol-3-yl)benzoate |
| SMILES | O=C(CCCO[N+](=O)[O-])Oc1cc(-c2cc(=S)ss2)ccc1C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C20H15NO7S3/c22-18(7-4-10-26-21(24)25)28-16-11-13(17-12-19(29)31-30-17)8-9-15(16)20(23)27-14-5-2-1-3-6-14/h1-3,5-6,8-9,11-12H,4,7,10H2 |
| InChIKey | LSGCNZWTGSRBQU-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|