C27H20FN3O8S3 — CID 127053234
[4-(5-sulfanylidenedithiol-3-yl)phenyl] 5-[(4-fluorophenyl)carbamoylamino]-2-(4-nitrooxybutanoyloxy)benzoate (PubChem CID 127053234) has the molecular formula C27H20FN3O8S3 and a molecular weight of 629.67 g/mol. Its IUPAC name is [4-(5-sulfanylidenedithiol-3-yl)phenyl] 5-[(4-fluorophenyl)carbamoylamino]-2-(4-nitrooxybutanoyloxy)benzoate.
| Compound Name | [4-(5-sulfanylidenedithiol-3-yl)phenyl] 5-[(4-fluorophenyl)carbamoylamino]-2-(4-nitrooxybutanoyloxy)benzoate |
|---|---|
| PubChem CID | 127053234 |
| Molecular Formula | C27H20FN3O8S3 |
| Molecular Weight | 629.67 g/mol |
| Exact Mass | 629.04 |
| IUPAC Name | [4-(5-sulfanylidenedithiol-3-yl)phenyl] 5-[(4-fluorophenyl)carbamoylamino]-2-(4-nitrooxybutanoyloxy)benzoate |
| SMILES | O=C(Nc1ccc(F)cc1)Nc1ccc(OC(=O)CCCO[N+](=O)[O-])c(C(=O)Oc2ccc(-c3cc(=S)ss3)cc2)c1 |
| InChI | InChI=1S/C27H20FN3O8S3/c28-17-5-7-18(8-6-17)29-27(34)30-19-9-12-22(39-24(32)2-1-13-37-31(35)36)21(14-19)26(33)38-20-10-3-16(4-11-20)23-15-25(40)42-41-23/h3-12,14-15H,1-2,13H2,(H2,29,30,34) |
| InChIKey | FRXDVDHWFLUAMW-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 146.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.67 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|