C22H20N2O7S3 — CID 90323488
[4-(5-sulfanylidenedithiol-3-yl)phenyl] 5-(dimethylamino)-2-(4-nitrooxybutanoyloxy)benzoate (PubChem CID 90323488) has the molecular formula C22H20N2O7S3 and a molecular weight of 520.61 g/mol. Its IUPAC name is [4-(5-sulfanylidenedithiol-3-yl)phenyl] 5-(dimethylamino)-2-(4-nitrooxybutanoyloxy)benzoate.
| Compound Name | [4-(5-sulfanylidenedithiol-3-yl)phenyl] 5-(dimethylamino)-2-(4-nitrooxybutanoyloxy)benzoate |
|---|---|
| PubChem CID | 90323488 |
| Molecular Formula | C22H20N2O7S3 |
| Molecular Weight | 520.61 g/mol |
| Exact Mass | 520.04 |
| IUPAC Name | [4-(5-sulfanylidenedithiol-3-yl)phenyl] 5-(dimethylamino)-2-(4-nitrooxybutanoyloxy)benzoate |
| SMILES | CN(C)c1ccc(OC(=O)CCCO[N+](=O)[O-])c(C(=O)Oc2ccc(-c3cc(=S)ss3)cc2)c1 |
| InChI | InChI=1S/C22H20N2O7S3/c1-23(2)15-7-10-18(31-20(25)4-3-11-29-24(27)28)17(12-15)22(26)30-16-8-5-14(6-9-16)19-13-21(32)34-33-19/h5-10,12-13H,3-4,11H2,1-2H3 |
| InChIKey | SURSCMVHUPJRAC-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 108.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.61 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|