C20H14ClNO7S3 — CID 122190296
[4-(5-sulfanylidenedithiol-3-yl)phenyl] 5-chloro-2-(4-nitrooxybutanoyloxy)benzoate (PubChem CID 122190296) has the molecular formula C20H14ClNO7S3 and a molecular weight of 511.99 g/mol. Its IUPAC name is [4-(5-sulfanylidenedithiol-3-yl)phenyl] 5-chloro-2-(4-nitrooxybutanoyloxy)benzoate.
| Compound Name | [4-(5-sulfanylidenedithiol-3-yl)phenyl] 5-chloro-2-(4-nitrooxybutanoyloxy)benzoate |
|---|---|
| PubChem CID | 122190296 |
| Molecular Formula | C20H14ClNO7S3 |
| Molecular Weight | 511.99 g/mol |
| Exact Mass | 510.96 |
| IUPAC Name | [4-(5-sulfanylidenedithiol-3-yl)phenyl] 5-chloro-2-(4-nitrooxybutanoyloxy)benzoate |
| SMILES | O=C(CCCO[N+](=O)[O-])Oc1ccc(Cl)cc1C(=O)Oc1ccc(-c2cc(=S)ss2)cc1 |
| InChI | InChI=1S/C20H14ClNO7S3/c21-13-5-8-16(29-18(23)2-1-9-27-22(25)26)15(10-13)20(24)28-14-6-3-12(4-7-14)17-11-19(30)32-31-17/h3-8,10-11H,1-2,9H2 |
| InChIKey | RTWUCLRNMQOKFH-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.99 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|