C40H30FNO9S4 — CID 144534398
[4-(5-sulfanylidenedithiol-3-yl)phenyl] 5-[2-[(3Z)-6-fluoro-2-methyl-3-[(4-methylsulfanylphenyl)methylidene]inden-1-yl]acetyl]oxy-2-(4-nitrooxybutanoyloxy)benzoate (PubChem CID 144534398) has the molecular formula C40H30FNO9S4 and a molecular weight of 815.94 g/mol. Its IUPAC name is [4-(5-sulfanylidenedithiol-3-yl)phenyl] 5-[2-[(3Z)-6-fluoro-2-methyl-3-[(4-methylsulfanylphenyl)methylidene]inden-1-yl]acetyl]oxy-2-(4-nitrooxybutanoyloxy)benzoate.
| Compound Name | [4-(5-sulfanylidenedithiol-3-yl)phenyl] 5-[2-[(3Z)-6-fluoro-2-methyl-3-[(4-methylsulfanylphenyl)methylidene]inden-1-yl]acetyl]oxy-2-(4-nitrooxybutanoyloxy)benzoate |
|---|---|
| PubChem CID | 144534398 |
| Molecular Formula | C40H30FNO9S4 |
| Molecular Weight | 815.94 g/mol |
| Exact Mass | 815.08 |
| IUPAC Name | [4-(5-sulfanylidenedithiol-3-yl)phenyl] 5-[2-[(3Z)-6-fluoro-2-methyl-3-[(4-methylsulfanylphenyl)methylidene]inden-1-yl]acetyl]oxy-2-(4-nitrooxybutanoyloxy)benzoate |
| SMILES | CSc1ccc(/C=C2/C(C)=C(CC(=O)Oc3ccc(OC(=O)CCCO[N+](=O)[O-])c(C(=O)Oc4ccc(-c5cc(=S)ss5)cc4)c3)c3cc(F)ccc32)cc1 |
| InChI | InChI=1S/C40H30FNO9S4/c1-23-31(18-24-5-13-29(53-2)14-6-24)30-15-9-26(41)19-33(30)32(23)21-38(44)49-28-12-16-35(51-37(43)4-3-17-48-42(46)47)34(20-28)40(45)50-27-10-7-25(8-11-27)36-22-39(52)55-54-36/h5-16,18-20,22H,3-4,17,21H2,1-2H3/b31-18- |
| InChIKey | GHXADEPXVYMBJK-MNBJERMJSA-N |
| XLogP | 10.50 |
| TPSA | 131.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.94 |
| LogP ≤ 5 | 10.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|