C34H31FN2O10S2 — CID 158117447
[3-(4-carbamothioylphenoxy)-2-[2-[6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]acetyl]oxy-3-oxopropyl] 4-nitrooxybutanoate (PubChem CID 158117447) has the molecular formula C34H31FN2O10S2 and a molecular weight of 710.76 g/mol. Its IUPAC name is [3-(4-carbamothioylphenoxy)-2-[2-[6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]acetyl]oxy-3-oxopropyl] 4-nitrooxybutanoate.
| Compound Name | [3-(4-carbamothioylphenoxy)-2-[2-[6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]acetyl]oxy-3-oxopropyl] 4-nitrooxybutanoate |
|---|---|
| PubChem CID | 158117447 |
| Molecular Formula | C34H31FN2O10S2 |
| Molecular Weight | 710.76 g/mol |
| Exact Mass | 710.14 |
| IUPAC Name | [3-(4-carbamothioylphenoxy)-2-[2-[6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]acetyl]oxy-3-oxopropyl] 4-nitrooxybutanoate |
| SMILES | CC1=C(CC(=O)OC(COC(=O)CCCO[N+](=O)[O-])C(=O)Oc2ccc(C(N)=S)cc2)c2cc(F)ccc2C1=Cc1ccc(S(C)=O)cc1 |
| InChI | InChI=1S/C34H31FN2O10S2/c1-20-27(16-21-5-12-25(13-6-21)49(2)43)26-14-9-23(35)17-29(26)28(20)18-32(39)47-30(19-44-31(38)4-3-15-45-37(41)42)34(40)46-24-10-7-22(8-11-24)33(36)48/h5-14,16-17,30H,3-4,15,18-19H2,1-2H3,(H2,36,48) |
| InChIKey | PDWPITFVFHQQSH-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 174.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.76 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|