C20H16FO2SSe — CID 174051324
CID 174051324 (PubChem CID 174051324) has the molecular formula C20H16FO2SSe and a molecular weight of 418.37 g/mol.
| Compound Name | CID 174051324 |
|---|---|
| PubChem CID | 174051324 |
| Molecular Formula | C20H16FO2SSe |
| Molecular Weight | 418.37 g/mol |
| Exact Mass | 419.00 |
| IUPAC Name | — |
| SMILES | CC1=C(CC(=O)[Se])c2cc(F)ccc2/C1=C\c1ccc(S(C)=O)cc1 |
| InChI | InChI=1S/C20H16FO2SSe/c1-12-17(9-13-3-6-15(7-4-13)24(2)23)16-8-5-14(21)10-19(16)18(12)11-20(22)25/h3-10H,11H2,1-2H3/b17-9- |
| InChIKey | IODZKHAUZYLLOJ-MFOYZWKCSA-N |
| XLogP | 3.98 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.37 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|